About (1R,2R)-1-bromo-1,2-dichloro-2-fluoroethane
(1R,2R)-1-bromo-1,2-dichloro-2-fluoroethane (PubChem CID 12714090) has the molecular formula C2H2BrCl2F
and a molecular weight of 195.85 g/mol. Its IUPAC name is (1R,2R)-1-bromo-1,2-dichloro-2-fluoroethane.
Molecular Properties
| Compound Name | (1R,2R)-1-bromo-1,2-dichloro-2-fluoroethane |
| PubChem CID | 12714090 |
| Molecular Formula | C2H2BrCl2F |
| Molecular Weight | 195.85 g/mol |
| Exact Mass | 193.87 |
| IUPAC Name | (1R,2R)-1-bromo-1,2-dichloro-2-fluoroethane |
| SMILES | F[C@H](Cl)[C@H](Cl)Br |
| InChI | InChI=1S/C2H2BrCl2F/c3-1(4)2(5)6/h1-2H/t1-,2-/m0/s1 |
| InChIKey | XDDJVEKMKAKCQM-LWMBPPNESA-N |
| XLogP | 2.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.85 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1R,2R)-1-bromo-1,2-dichloro-2-fluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-1-bromo-1,2-dichloro-2-fluoroethane?
The IUPAC name of (1R,2R)-1-bromo-1,2-dichloro-2-fluoroethane (CID 12714090) is (1R,2R)-1-bromo-1,2-dichloro-2-fluoroethane.
What is the SMILES notation for (1R,2R)-1-bromo-1,2-dichloro-2-fluoroethane?
The canonical SMILES for (1R,2R)-1-bromo-1,2-dichloro-2-fluoroethane is F[C@H](Cl)[C@H](Cl)Br.
What is the InChIKey of (1R,2R)-1-bromo-1,2-dichloro-2-fluoroethane?
The InChIKey is XDDJVEKMKAKCQM-LWMBPPNESA-N. The full InChI is InChI=1S/C2H2BrCl2F/c3-1(4)2(5)6/h1-2H/t1-,2-/m0/s1.
What are the key properties of (1R,2R)-1-bromo-1,2-dichloro-2-fluoroethane?
(1R,2R)-1-bromo-1,2-dichloro-2-fluoroethane has a molecular weight of 195.85 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-1-bromo-1,2-dichloro-2-fluoroethane is sourced from PubChem (CID 12714090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).