About trans-(1R,2R)-1,2-ditert-butylcyclopropane
trans-(1R,2R)-1,2-ditert-butylcyclopropane (PubChem CID 12714135) has the molecular formula C11H22
and a molecular weight of 154.30 g/mol. Its IUPAC name is trans-(1R,2R)-1,2-ditert-butylcyclopropane.
Molecular Properties
| Compound Name | trans-(1R,2R)-1,2-ditert-butylcyclopropane |
| PubChem CID | 12714135 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | trans-(1R,2R)-1,2-ditert-butylcyclopropane |
| SMILES | CC(C)(C)[C@@H]1C[C@H]1C(C)(C)C |
| InChI | InChI=1S/C11H22/c1-10(2,3)8-7-9(8)11(4,5)6/h8-9H,7H2,1-6H3/t8-,9-/m1/s1 |
| InChIKey | HKHYLUHRWNEUEI-RKDXNWHRSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze trans-(1R,2R)-1,2-ditert-butylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-1,2-ditert-butylcyclopropane?
The IUPAC name of trans-(1R,2R)-1,2-ditert-butylcyclopropane (CID 12714135) is trans-(1R,2R)-1,2-ditert-butylcyclopropane.
What is the SMILES notation for trans-(1R,2R)-1,2-ditert-butylcyclopropane?
The canonical SMILES for trans-(1R,2R)-1,2-ditert-butylcyclopropane is CC(C)(C)[C@@H]1C[C@H]1C(C)(C)C.
What is the InChIKey of trans-(1R,2R)-1,2-ditert-butylcyclopropane?
The InChIKey is HKHYLUHRWNEUEI-RKDXNWHRSA-N. The full InChI is InChI=1S/C11H22/c1-10(2,3)8-7-9(8)11(4,5)6/h8-9H,7H2,1-6H3/t8-,9-/m1/s1.
What are the key properties of trans-(1R,2R)-1,2-ditert-butylcyclopropane?
trans-(1R,2R)-1,2-ditert-butylcyclopropane has a molecular weight of 154.30 g/mol, XLogP of 3.71, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-1,2-ditert-butylcyclopropane is sourced from PubChem (CID 12714135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).