C22H28N4O2 — CID 127145528
4-(cyclohexanecarbonylamino)-N-quinolin-8-ylpiperidine-1-carboxamide (PubChem CID 127145528) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 4-(cyclohexanecarbonylamino)-N-quinolin-8-ylpiperidine-1-carboxamide.
| Compound Name | 4-(cyclohexanecarbonylamino)-N-quinolin-8-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 127145528 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 4-(cyclohexanecarbonylamino)-N-quinolin-8-ylpiperidine-1-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)Nc2cccc3cccnc23)CC1)C1CCCCC1 |
| InChI | InChI=1S/C22H28N4O2/c27-21(17-6-2-1-3-7-17)24-18-11-14-26(15-12-18)22(28)25-19-10-4-8-16-9-5-13-23-20(16)19/h4-5,8-10,13,17-18H,1-3,6-7,11-12,14-15H2,(H,24,27)(H,25,28) |
| InChIKey | WBEGIQJDERAFPY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |