C12H16O4 — CID 12715004
methyl (3aR,4R,5R,7aS)-4,5-dimethyl-3-oxo-1,3a,5,7a-tetrahydro-2-benzofuran-4-carboxylate (PubChem CID 12715004) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is methyl (3aR,4R,5R,7aS)-4,5-dimethyl-3-oxo-1,3a,5,7a-tetrahydro-2-benzofuran-4-carboxylate.
| Compound Name | methyl (3aR,4R,5R,7aS)-4,5-dimethyl-3-oxo-1,3a,5,7a-tetrahydro-2-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 12715004 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | methyl (3aR,4R,5R,7aS)-4,5-dimethyl-3-oxo-1,3a,5,7a-tetrahydro-2-benzofuran-4-carboxylate |
| SMILES | COC(=O)[C@]1(C)[C@H](C)C=C[C@@H]2COC(=O)[C@H]21 |
| InChI | InChI=1S/C12H16O4/c1-7-4-5-8-6-16-10(13)9(8)12(7,2)11(14)15-3/h4-5,7-9H,6H2,1-3H3/t7-,8-,9+,12-/m1/s1 |
| InChIKey | PKBNKRYMIKLVRW-KZFFXBSXSA-N |
| XLogP | 1.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|