About 2-[(1E)-buta-1,3-dienyl]aniline
2-[(1E)-buta-1,3-dienyl]aniline (PubChem CID 12715427) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is 2-[(1E)-buta-1,3-dienyl]aniline.
Molecular Properties
| Compound Name | 2-[(1E)-buta-1,3-dienyl]aniline |
| PubChem CID | 12715427 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2-[(1E)-buta-1,3-dienyl]aniline |
| SMILES | C=C/C=C/c1ccccc1N |
| InChI | InChI=1S/C10H11N/c1-2-3-6-9-7-4-5-8-10(9)11/h2-8H,1,11H2/b6-3+ |
| InChIKey | HESQEUJEXRPQNL-ZZXKWVIFSA-N |
| XLogP | 2.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E)-buta-1,3-dienyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E)-buta-1,3-dienyl]aniline?
The IUPAC name of 2-[(1E)-buta-1,3-dienyl]aniline (CID 12715427) is 2-[(1E)-buta-1,3-dienyl]aniline.
What is the SMILES notation for 2-[(1E)-buta-1,3-dienyl]aniline?
The canonical SMILES for 2-[(1E)-buta-1,3-dienyl]aniline is C=C/C=C/c1ccccc1N.
What is the InChIKey of 2-[(1E)-buta-1,3-dienyl]aniline?
The InChIKey is HESQEUJEXRPQNL-ZZXKWVIFSA-N. The full InChI is InChI=1S/C10H11N/c1-2-3-6-9-7-4-5-8-10(9)11/h2-8H,1,11H2/b6-3+.
What are the key properties of 2-[(1E)-buta-1,3-dienyl]aniline?
2-[(1E)-buta-1,3-dienyl]aniline has a molecular weight of 145.20 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E)-buta-1,3-dienyl]aniline is sourced from PubChem (CID 12715427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).