C13H20O — CID 12715944
4-(methoxymethyl)undeca-1,5,6,10-tetraene (PubChem CID 12715944) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 4-(methoxymethyl)undeca-1,5,6,10-tetraene.
| Compound Name | 4-(methoxymethyl)undeca-1,5,6,10-tetraene |
|---|---|
| PubChem CID | 12715944 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 4-(methoxymethyl)undeca-1,5,6,10-tetraene |
| SMILES | C=CCCC=C=CC(CC=C)COC |
| InChI | InChI=1S/C13H20O/c1-4-6-7-8-9-11-13(10-5-2)12-14-3/h4-5,8,11,13H,1-2,6-7,10,12H2,3H3 |
| InChIKey | MPAFUJZKARNMNI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|