C14H23N — CID 12715945
N,N-dimethyl-2-prop-2-enylnona-3,4,8-trien-1-amine (PubChem CID 12715945) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is N,N-dimethyl-2-prop-2-enylnona-3,4,8-trien-1-amine.
| Compound Name | N,N-dimethyl-2-prop-2-enylnona-3,4,8-trien-1-amine |
|---|---|
| PubChem CID | 12715945 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N,N-dimethyl-2-prop-2-enylnona-3,4,8-trien-1-amine |
| SMILES | C=CCCC=C=CC(CC=C)CN(C)C |
| InChI | InChI=1S/C14H23N/c1-5-7-8-9-10-12-14(11-6-2)13-15(3)4/h5-6,9,12,14H,1-2,7-8,11,13H2,3-4H3 |
| InChIKey | KBBYICUFUGRAAW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|