C21H22F3N3O2 — CID 127163779
4-benzamido-N-[[3-(trifluoromethyl)phenyl]methyl]piperidine-1-carboxamide (PubChem CID 127163779) has the molecular formula C21H22F3N3O2 and a molecular weight of 405.42 g/mol. Its IUPAC name is 4-benzamido-N-[[3-(trifluoromethyl)phenyl]methyl]piperidine-1-carboxamide.
| Compound Name | 4-benzamido-N-[[3-(trifluoromethyl)phenyl]methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 127163779 |
| Molecular Formula | C21H22F3N3O2 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 4-benzamido-N-[[3-(trifluoromethyl)phenyl]methyl]piperidine-1-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)NCc2cccc(C(F)(F)F)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H22F3N3O2/c22-21(23,24)17-8-4-5-15(13-17)14-25-20(29)27-11-9-18(10-12-27)26-19(28)16-6-2-1-3-7-16/h1-8,13,18H,9-12,14H2,(H,25,29)(H,26,28) |
| InChIKey | PLJPFNLOGXTFOI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |