About tritert-butylborane
tritert-butylborane (PubChem CID 12716805) has the molecular formula C12H27B
and a molecular weight of 182.16 g/mol. Its IUPAC name is tritert-butylborane.
Molecular Properties
| Compound Name | tritert-butylborane |
| PubChem CID | 12716805 |
| Molecular Formula | C12H27B |
| Molecular Weight | 182.16 g/mol |
| Exact Mass | 182.22 |
| IUPAC Name | tritert-butylborane |
| SMILES | CC(C)(C)B(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H27B/c1-10(2,3)13(11(4,5)6)12(7,8)9/h1-9H3 |
| InChIKey | HWWBSHOPAPTOMP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.16 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tritert-butylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tritert-butylborane?
The IUPAC name of tritert-butylborane (CID 12716805) is tritert-butylborane.
What is the SMILES notation for tritert-butylborane?
The canonical SMILES for tritert-butylborane is CC(C)(C)B(C(C)(C)C)C(C)(C)C.
What is the InChIKey of tritert-butylborane?
The InChIKey is HWWBSHOPAPTOMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27B/c1-10(2,3)13(11(4,5)6)12(7,8)9/h1-9H3.
What are the key properties of tritert-butylborane?
tritert-butylborane has a molecular weight of 182.16 g/mol, XLogP of 4.88, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tritert-butylborane is sourced from PubChem (CID 12716805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).