About S-ethyl 6-hydroxyhexanethioate
S-ethyl 6-hydroxyhexanethioate (PubChem CID 12717368) has the molecular formula C8H16O2S
and a molecular weight of 176.28 g/mol. Its IUPAC name is S-ethyl 6-hydroxyhexanethioate.
Molecular Properties
| Compound Name | S-ethyl 6-hydroxyhexanethioate |
| PubChem CID | 12717368 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | S-ethyl 6-hydroxyhexanethioate |
| SMILES | CCSC(=O)CCCCCO |
| InChI | InChI=1S/C8H16O2S/c1-2-11-8(10)6-4-3-5-7-9/h9H,2-7H2,1H3 |
| InChIKey | OMOHAGVADVJUBE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl 6-hydroxyhexanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl 6-hydroxyhexanethioate?
The IUPAC name of S-ethyl 6-hydroxyhexanethioate (CID 12717368) is S-ethyl 6-hydroxyhexanethioate.
What is the SMILES notation for S-ethyl 6-hydroxyhexanethioate?
The canonical SMILES for S-ethyl 6-hydroxyhexanethioate is CCSC(=O)CCCCCO.
What is the InChIKey of S-ethyl 6-hydroxyhexanethioate?
The InChIKey is OMOHAGVADVJUBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2S/c1-2-11-8(10)6-4-3-5-7-9/h9H,2-7H2,1H3.
What are the key properties of S-ethyl 6-hydroxyhexanethioate?
S-ethyl 6-hydroxyhexanethioate has a molecular weight of 176.28 g/mol, XLogP of 1.82, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl 6-hydroxyhexanethioate is sourced from PubChem (CID 12717368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).