About 4'-(dimethylamino)spiro[2-benzofuran-3,1'-cyclohexane]-1-one;hydrochloride
4'-(dimethylamino)spiro[2-benzofuran-3,1'-cyclohexane]-1-one;hydrochloride (PubChem CID 12717450) has the molecular formula C15H20ClNO2
and a molecular weight of 281.78 g/mol. Its IUPAC name is 4'-(dimethylamino)spiro[2-benzofuran-3,1'-cyclohexane]-1-one;hydrochloride.
Molecular Properties
| Compound Name | 4'-(dimethylamino)spiro[2-benzofuran-3,1'-cyclohexane]-1-one;hydrochloride |
| PubChem CID | 12717450 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 4'-(dimethylamino)spiro[2-benzofuran-3,1'-cyclohexane]-1-one;hydrochloride |
| SMILES | CN(C)C1CCC2(CC1)OC(=O)c1ccccc12.Cl |
| InChI | InChI=1S/C15H19NO2.ClH/c1-16(2)11-7-9-15(10-8-11)13-6-4-3-5-12(13)14(17)18-15;/h3-6,11H,7-10H2,1-2H3;1H |
| InChIKey | FOAVAYPYBZXHBB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4'-(dimethylamino)spiro[2-benzofuran-3,1'-cyclohexane]-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-(dimethylamino)spiro[2-benzofuran-3,1'-cyclohexane]-1-one;hydrochloride?
The IUPAC name of 4'-(dimethylamino)spiro[2-benzofuran-3,1'-cyclohexane]-1-one;hydrochloride (CID 12717450) is 4'-(dimethylamino)spiro[2-benzofuran-3,1'-cyclohexane]-1-one;hydrochloride.
What is the SMILES notation for 4'-(dimethylamino)spiro[2-benzofuran-3,1'-cyclohexane]-1-one;hydrochloride?
The canonical SMILES for 4'-(dimethylamino)spiro[2-benzofuran-3,1'-cyclohexane]-1-one;hydrochloride is CN(C)C1CCC2(CC1)OC(=O)c1ccccc12.Cl.
What is the InChIKey of 4'-(dimethylamino)spiro[2-benzofuran-3,1'-cyclohexane]-1-one;hydrochloride?
The InChIKey is FOAVAYPYBZXHBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO2.ClH/c1-16(2)11-7-9-15(10-8-11)13-6-4-3-5-12(13)14(17)18-15;/h3-6,11H,7-10H2,1-2H3;1H.
What are the key properties of 4'-(dimethylamino)spiro[2-benzofuran-3,1'-cyclohexane]-1-one;hydrochloride?
4'-(dimethylamino)spiro[2-benzofuran-3,1'-cyclohexane]-1-one;hydrochloride has a molecular weight of 281.78 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-(dimethylamino)spiro[2-benzofuran-3,1'-cyclohexane]-1-one;hydrochloride is sourced from PubChem (CID 12717450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).