About 1-(4-fluorophenyl)-N,N-dimethylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine
1-(4-fluorophenyl)-N,N-dimethylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine (PubChem CID 12717460) has the molecular formula C21H24FNO
and a molecular weight of 325.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N,N-dimethylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-N,N-dimethylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine |
| PubChem CID | 12717460 |
| Molecular Formula | C21H24FNO |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 1-(4-fluorophenyl)-N,N-dimethylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine |
| SMILES | CN(C)C1CCC2(CC1)OC(c1ccc(F)cc1)c1ccccc12 |
| InChI | InChI=1S/C21H24FNO/c1-23(2)17-11-13-21(14-12-17)19-6-4-3-5-18(19)20(24-21)15-7-9-16(22)10-8-15/h3-10,17,20H,11-14H2,1-2H3 |
| InChIKey | KUOVTWGERDLEKI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-fluorophenyl)-N,N-dimethylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-N,N-dimethylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine?
The IUPAC name of 1-(4-fluorophenyl)-N,N-dimethylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine (CID 12717460) is 1-(4-fluorophenyl)-N,N-dimethylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine.
What is the SMILES notation for 1-(4-fluorophenyl)-N,N-dimethylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine?
The canonical SMILES for 1-(4-fluorophenyl)-N,N-dimethylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine is CN(C)C1CCC2(CC1)OC(c1ccc(F)cc1)c1ccccc12.
What is the InChIKey of 1-(4-fluorophenyl)-N,N-dimethylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine?
The InChIKey is KUOVTWGERDLEKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24FNO/c1-23(2)17-11-13-21(14-12-17)19-6-4-3-5-18(19)20(24-21)15-7-9-16(22)10-8-15/h3-10,17,20H,11-14H2,1-2H3.
What are the key properties of 1-(4-fluorophenyl)-N,N-dimethylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine?
1-(4-fluorophenyl)-N,N-dimethylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine has a molecular weight of 325.43 g/mol, XLogP of 4.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-N,N-dimethylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine is sourced from PubChem (CID 12717460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).