C24H29NO5 — CID 12717470
oxalic acid;N,N,3-trimethyl-3-phenylspiro[2-benzofuran-1,4'-cyclohexane]-1'-amine (PubChem CID 12717470) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is oxalic acid;N,N,3-trimethyl-3-phenylspiro[2-benzofuran-1,4'-cyclohexane]-1'-amine.
| Compound Name | oxalic acid;N,N,3-trimethyl-3-phenylspiro[2-benzofuran-1,4'-cyclohexane]-1'-amine |
|---|---|
| PubChem CID | 12717470 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | oxalic acid;N,N,3-trimethyl-3-phenylspiro[2-benzofuran-1,4'-cyclohexane]-1'-amine |
| SMILES | CN(C)C1CCC2(CC1)OC(C)(c1ccccc1)c1ccccc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H27NO.C2H2O4/c1-21(17-9-5-4-6-10-17)19-11-7-8-12-20(19)22(24-21)15-13-18(14-16-22)23(2)3;3-1(4)2(5)6/h4-12,18H,13-16H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | ALACNEGRNNCQCS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|