About [(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]oxy-trimethylsilane
[(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]oxy-trimethylsilane (PubChem CID 12717545) has the molecular formula C11H22OSi
and a molecular weight of 198.38 g/mol. Its IUPAC name is [(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]oxy-trimethylsilane |
| PubChem CID | 12717545 |
| Molecular Formula | C11H22OSi |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | [(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]oxy-trimethylsilane |
| SMILES | C=C/C=C(\O[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H22OSi/c1-8-9-10(11(2,3)4)12-13(5,6)7/h8-9H,1H2,2-7H3/b10-9- |
| InChIKey | KPGRKESBAFRFDM-KTKRTIGZSA-N |
| XLogP | 3.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]oxy-trimethylsilane?
The IUPAC name of [(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]oxy-trimethylsilane (CID 12717545) is [(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]oxy-trimethylsilane.
What is the SMILES notation for [(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]oxy-trimethylsilane?
The canonical SMILES for [(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]oxy-trimethylsilane is C=C/C=C(\O[Si](C)(C)C)C(C)(C)C.
What is the InChIKey of [(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]oxy-trimethylsilane?
The InChIKey is KPGRKESBAFRFDM-KTKRTIGZSA-N. The full InChI is InChI=1S/C11H22OSi/c1-8-9-10(11(2,3)4)12-13(5,6)7/h8-9H,1H2,2-7H3/b10-9-.
What are the key properties of [(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]oxy-trimethylsilane?
[(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]oxy-trimethylsilane has a molecular weight of 198.38 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]oxy-trimethylsilane is sourced from PubChem (CID 12717545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).