About ethyl 2-(1,3-dithian-2-yl)but-3-enoate
ethyl 2-(1,3-dithian-2-yl)but-3-enoate (PubChem CID 12717552) has the molecular formula C10H16O2S2
and a molecular weight of 232.37 g/mol. Its IUPAC name is ethyl 2-(1,3-dithian-2-yl)but-3-enoate.
Molecular Properties
| Compound Name | ethyl 2-(1,3-dithian-2-yl)but-3-enoate |
| PubChem CID | 12717552 |
| Molecular Formula | C10H16O2S2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | ethyl 2-(1,3-dithian-2-yl)but-3-enoate |
| SMILES | C=CC(C(=O)OCC)C1SCCCS1 |
| InChI | InChI=1S/C10H16O2S2/c1-3-8(9(11)12-4-2)10-13-6-5-7-14-10/h3,8,10H,1,4-7H2,2H3 |
| InChIKey | JHWRJRIAVKIXNW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(1,3-dithian-2-yl)but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(1,3-dithian-2-yl)but-3-enoate?
The IUPAC name of ethyl 2-(1,3-dithian-2-yl)but-3-enoate (CID 12717552) is ethyl 2-(1,3-dithian-2-yl)but-3-enoate.
What is the SMILES notation for ethyl 2-(1,3-dithian-2-yl)but-3-enoate?
The canonical SMILES for ethyl 2-(1,3-dithian-2-yl)but-3-enoate is C=CC(C(=O)OCC)C1SCCCS1.
What is the InChIKey of ethyl 2-(1,3-dithian-2-yl)but-3-enoate?
The InChIKey is JHWRJRIAVKIXNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2S2/c1-3-8(9(11)12-4-2)10-13-6-5-7-14-10/h3,8,10H,1,4-7H2,2H3.
What are the key properties of ethyl 2-(1,3-dithian-2-yl)but-3-enoate?
ethyl 2-(1,3-dithian-2-yl)but-3-enoate has a molecular weight of 232.37 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(1,3-dithian-2-yl)but-3-enoate is sourced from PubChem (CID 12717552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).