C14H29NO5 — CID 12717860
14,18-dimethyl-1,4,7,10,13-pentaoxa-16-azacyclooctadecane (PubChem CID 12717860) has the molecular formula C14H29NO5 and a molecular weight of 291.39 g/mol. Its IUPAC name is 14,18-dimethyl-1,4,7,10,13-pentaoxa-16-azacyclooctadecane.
| Compound Name | 14,18-dimethyl-1,4,7,10,13-pentaoxa-16-azacyclooctadecane |
|---|---|
| PubChem CID | 12717860 |
| Molecular Formula | C14H29NO5 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 14,18-dimethyl-1,4,7,10,13-pentaoxa-16-azacyclooctadecane |
| SMILES | CC1CNCC(C)OCCOCCOCCOCCO1 |
| InChI | InChI=1S/C14H29NO5/c1-13-11-15-12-14(2)20-10-8-18-6-4-16-3-5-17-7-9-19-13/h13-15H,3-12H2,1-2H3 |
| InChIKey | FVBSVZZRWQOUPT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |