About N,5-dimethyl-3-propyl-1,3-thiazolidin-2-imine
N,5-dimethyl-3-propyl-1,3-thiazolidin-2-imine (PubChem CID 12718851) has the molecular formula C8H16N2S
and a molecular weight of 172.30 g/mol. Its IUPAC name is N,5-dimethyl-3-propyl-1,3-thiazolidin-2-imine.
Molecular Properties
| Compound Name | N,5-dimethyl-3-propyl-1,3-thiazolidin-2-imine |
| PubChem CID | 12718851 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | N,5-dimethyl-3-propyl-1,3-thiazolidin-2-imine |
| SMILES | CCCN1CC(C)S/C1=N\C |
| InChI | InChI=1S/C8H16N2S/c1-4-5-10-6-7(2)11-8(10)9-3/h7H,4-6H2,1-3H3/b9-8- |
| InChIKey | IRDDFGLFBZNYLO-HJWRWDBZSA-N |
| XLogP | 1.82 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,5-dimethyl-3-propyl-1,3-thiazolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-dimethyl-3-propyl-1,3-thiazolidin-2-imine?
The IUPAC name of N,5-dimethyl-3-propyl-1,3-thiazolidin-2-imine (CID 12718851) is N,5-dimethyl-3-propyl-1,3-thiazolidin-2-imine.
What is the SMILES notation for N,5-dimethyl-3-propyl-1,3-thiazolidin-2-imine?
The canonical SMILES for N,5-dimethyl-3-propyl-1,3-thiazolidin-2-imine is CCCN1CC(C)S/C1=N\C.
What is the InChIKey of N,5-dimethyl-3-propyl-1,3-thiazolidin-2-imine?
The InChIKey is IRDDFGLFBZNYLO-HJWRWDBZSA-N. The full InChI is InChI=1S/C8H16N2S/c1-4-5-10-6-7(2)11-8(10)9-3/h7H,4-6H2,1-3H3/b9-8-.
What are the key properties of N,5-dimethyl-3-propyl-1,3-thiazolidin-2-imine?
N,5-dimethyl-3-propyl-1,3-thiazolidin-2-imine has a molecular weight of 172.30 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-dimethyl-3-propyl-1,3-thiazolidin-2-imine is sourced from PubChem (CID 12718851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).