About (3,5-dimethyl-1,3-thiazolidin-2-ylidene)-dimethylazanium
(3,5-dimethyl-1,3-thiazolidin-2-ylidene)-dimethylazanium (PubChem CID 12718861) has the molecular formula C7H15N2S+
and a molecular weight of 159.28 g/mol. Its IUPAC name is (3,5-dimethyl-1,3-thiazolidin-2-ylidene)-dimethylazanium.
Molecular Properties
| Compound Name | (3,5-dimethyl-1,3-thiazolidin-2-ylidene)-dimethylazanium |
| PubChem CID | 12718861 |
| Molecular Formula | C7H15N2S+ |
| Molecular Weight | 159.28 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | (3,5-dimethyl-1,3-thiazolidin-2-ylidene)-dimethylazanium |
| SMILES | CC1CN(C)C(=[N+](C)C)S1 |
| InChI | InChI=1S/C7H15N2S/c1-6-5-9(4)7(10-6)8(2)3/h6H,5H2,1-4H3/q+1 |
| InChIKey | JTULDGHVRAOLNT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dimethyl-1,3-thiazolidin-2-ylidene)-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethyl-1,3-thiazolidin-2-ylidene)-dimethylazanium?
The IUPAC name of (3,5-dimethyl-1,3-thiazolidin-2-ylidene)-dimethylazanium (CID 12718861) is (3,5-dimethyl-1,3-thiazolidin-2-ylidene)-dimethylazanium.
What is the SMILES notation for (3,5-dimethyl-1,3-thiazolidin-2-ylidene)-dimethylazanium?
The canonical SMILES for (3,5-dimethyl-1,3-thiazolidin-2-ylidene)-dimethylazanium is CC1CN(C)C(=[N+](C)C)S1.
What is the InChIKey of (3,5-dimethyl-1,3-thiazolidin-2-ylidene)-dimethylazanium?
The InChIKey is JTULDGHVRAOLNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N2S/c1-6-5-9(4)7(10-6)8(2)3/h6H,5H2,1-4H3/q+1.
What are the key properties of (3,5-dimethyl-1,3-thiazolidin-2-ylidene)-dimethylazanium?
(3,5-dimethyl-1,3-thiazolidin-2-ylidene)-dimethylazanium has a molecular weight of 159.28 g/mol, XLogP of 0.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethyl-1,3-thiazolidin-2-ylidene)-dimethylazanium is sourced from PubChem (CID 12718861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).