About (3-ethyl-5-methyl-1,3-thiazolidin-2-ylidene)-dimethylazanium
(3-ethyl-5-methyl-1,3-thiazolidin-2-ylidene)-dimethylazanium (PubChem CID 12718863) has the molecular formula C8H17N2S+
and a molecular weight of 173.30 g/mol. Its IUPAC name is (3-ethyl-5-methyl-1,3-thiazolidin-2-ylidene)-dimethylazanium.
Molecular Properties
| Compound Name | (3-ethyl-5-methyl-1,3-thiazolidin-2-ylidene)-dimethylazanium |
| PubChem CID | 12718863 |
| Molecular Formula | C8H17N2S+ |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (3-ethyl-5-methyl-1,3-thiazolidin-2-ylidene)-dimethylazanium |
| SMILES | CCN1CC(C)SC1=[N+](C)C |
| InChI | InChI=1S/C8H17N2S/c1-5-10-6-7(2)11-8(10)9(3)4/h7H,5-6H2,1-4H3/q+1 |
| InChIKey | PLKNMVDJVKVPEB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (3-ethyl-5-methyl-1,3-thiazolidin-2-ylidene)-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-5-methyl-1,3-thiazolidin-2-ylidene)-dimethylazanium?
The IUPAC name of (3-ethyl-5-methyl-1,3-thiazolidin-2-ylidene)-dimethylazanium (CID 12718863) is (3-ethyl-5-methyl-1,3-thiazolidin-2-ylidene)-dimethylazanium.
What is the SMILES notation for (3-ethyl-5-methyl-1,3-thiazolidin-2-ylidene)-dimethylazanium?
The canonical SMILES for (3-ethyl-5-methyl-1,3-thiazolidin-2-ylidene)-dimethylazanium is CCN1CC(C)SC1=[N+](C)C.
What is the InChIKey of (3-ethyl-5-methyl-1,3-thiazolidin-2-ylidene)-dimethylazanium?
The InChIKey is PLKNMVDJVKVPEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N2S/c1-5-10-6-7(2)11-8(10)9(3)4/h7H,5-6H2,1-4H3/q+1.
What are the key properties of (3-ethyl-5-methyl-1,3-thiazolidin-2-ylidene)-dimethylazanium?
(3-ethyl-5-methyl-1,3-thiazolidin-2-ylidene)-dimethylazanium has a molecular weight of 173.30 g/mol, XLogP of 1.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-5-methyl-1,3-thiazolidin-2-ylidene)-dimethylazanium is sourced from PubChem (CID 12718863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).