About N,N,5-trimethyl-4,5-dihydro-1,3-thiazol-2-amine
N,N,5-trimethyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 12718867) has the molecular formula C6H12N2S
and a molecular weight of 144.24 g/mol. Its IUPAC name is N,N,5-trimethyl-4,5-dihydro-1,3-thiazol-2-amine.
Analyze N,N,5-trimethyl-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,5-trimethyl-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of N,N,5-trimethyl-4,5-dihydro-1,3-thiazol-2-amine (CID 12718867) is N,N,5-trimethyl-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for N,N,5-trimethyl-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for N,N,5-trimethyl-4,5-dihydro-1,3-thiazol-2-amine is CC1CN=C(N(C)C)S1.
What is the InChIKey of N,N,5-trimethyl-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is HCPPZNNWPHWYKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2S/c1-5-4-7-6(9-5)8(2)3/h5H,4H2,1-3H3.
What are the key properties of N,N,5-trimethyl-4,5-dihydro-1,3-thiazol-2-amine?
N,N,5-trimethyl-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 144.24 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,5-trimethyl-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 12718867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).