C19H27N3O — CID 12720232
3-(1-adamantyl)-5,5,7,7-tetramethylfuro[3,4-e][1,2,4]triazine (PubChem CID 12720232) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is 3-(1-adamantyl)-5,5,7,7-tetramethylfuro[3,4-e][1,2,4]triazine.
| Compound Name | 3-(1-adamantyl)-5,5,7,7-tetramethylfuro[3,4-e][1,2,4]triazine |
|---|---|
| PubChem CID | 12720232 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 3-(1-adamantyl)-5,5,7,7-tetramethylfuro[3,4-e][1,2,4]triazine |
| SMILES | CC1(C)OC(C)(C)c2nc(C34CC5CC(CC(C5)C3)C4)nnc21 |
| InChI | InChI=1S/C19H27N3O/c1-17(2)14-15(18(3,4)23-17)21-22-16(20-14)19-8-11-5-12(9-19)7-13(6-11)10-19/h11-13H,5-10H2,1-4H3 |
| InChIKey | VBVCGWZRUZGOAT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |