C16H18N2O2 — CID 12720239
5,5,7,7-tetramethyl-4-oxido-3-phenylfuro[3,4-b]pyrazin-4-ium (PubChem CID 12720239) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 5,5,7,7-tetramethyl-4-oxido-3-phenylfuro[3,4-b]pyrazin-4-ium.
| Compound Name | 5,5,7,7-tetramethyl-4-oxido-3-phenylfuro[3,4-b]pyrazin-4-ium |
|---|---|
| PubChem CID | 12720239 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 5,5,7,7-tetramethyl-4-oxido-3-phenylfuro[3,4-b]pyrazin-4-ium |
| SMILES | CC1(C)OC(C)(C)c2c1ncc(-c1ccccc1)[n+]2[O-] |
| InChI | InChI=1S/C16H18N2O2/c1-15(2)13-14(16(3,4)20-15)18(19)12(10-17-13)11-8-6-5-7-9-11/h5-10H,1-4H3 |
| InChIKey | XCUAOWZLMIPZKU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|