C12H8F4 — CID 12720558
1,2,3,4-tetrafluoro-6,7-dimethylnaphthalene (PubChem CID 12720558) has the molecular formula C12H8F4 and a molecular weight of 228.19 g/mol. Its IUPAC name is 1,2,3,4-tetrafluoro-6,7-dimethylnaphthalene.
| Compound Name | 1,2,3,4-tetrafluoro-6,7-dimethylnaphthalene |
|---|---|
| PubChem CID | 12720558 |
| Molecular Formula | C12H8F4 |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 1,2,3,4-tetrafluoro-6,7-dimethylnaphthalene |
| SMILES | Cc1cc2c(F)c(F)c(F)c(F)c2cc1C |
| InChI | InChI=1S/C12H8F4/c1-5-3-7-8(4-6(5)2)10(14)12(16)11(15)9(7)13/h3-4H,1-2H3 |
| InChIKey | YDAJJIVFTHZYOQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|