About 1,4-ditert-butylpiperidine
1,4-ditert-butylpiperidine (PubChem CID 12722194) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is 1,4-ditert-butylpiperidine.
Molecular Properties
| Compound Name | 1,4-ditert-butylpiperidine |
| PubChem CID | 12722194 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 1,4-ditert-butylpiperidine |
| SMILES | CC(C)(C)C1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H27N/c1-12(2,3)11-7-9-14(10-8-11)13(4,5)6/h11H,7-10H2,1-6H3 |
| InChIKey | DAZLXPUSMBNBGA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4-ditert-butylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-ditert-butylpiperidine?
The IUPAC name of 1,4-ditert-butylpiperidine (CID 12722194) is 1,4-ditert-butylpiperidine.
What is the SMILES notation for 1,4-ditert-butylpiperidine?
The canonical SMILES for 1,4-ditert-butylpiperidine is CC(C)(C)C1CCN(C(C)(C)C)CC1.
What is the InChIKey of 1,4-ditert-butylpiperidine?
The InChIKey is DAZLXPUSMBNBGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N/c1-12(2,3)11-7-9-14(10-8-11)13(4,5)6/h11H,7-10H2,1-6H3.
What are the key properties of 1,4-ditert-butylpiperidine?
1,4-ditert-butylpiperidine has a molecular weight of 197.37 g/mol, XLogP of 3.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-ditert-butylpiperidine is sourced from PubChem (CID 12722194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).