C6HF7 — CID 12722398
1,2,4,5,5,6,6-heptafluorocyclohexa-1,3-diene (PubChem CID 12722398) has the molecular formula C6HF7 and a molecular weight of 206.06 g/mol. Its IUPAC name is 1,2,4,5,5,6,6-heptafluorocyclohexa-1,3-diene.
| Compound Name | 1,2,4,5,5,6,6-heptafluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 12722398 |
| Molecular Formula | C6HF7 |
| Molecular Weight | 206.06 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | 1,2,4,5,5,6,6-heptafluorocyclohexa-1,3-diene |
| SMILES | FC1=CC(F)=C(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6HF7/c7-2-1-3(8)5(10,11)6(12,13)4(2)9/h1H |
| InChIKey | XTXUYSZVBBKNLR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.06 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|