About 2,4,6-trimethoxybenzenethiol
2,4,6-trimethoxybenzenethiol (PubChem CID 12723003) has the molecular formula C9H12O3S
and a molecular weight of 200.26 g/mol. Its IUPAC name is 2,4,6-trimethoxybenzenethiol.
Molecular Properties
| Compound Name | 2,4,6-trimethoxybenzenethiol |
| PubChem CID | 12723003 |
| Molecular Formula | C9H12O3S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 2,4,6-trimethoxybenzenethiol |
| SMILES | COc1cc(OC)c(S)c(OC)c1 |
| InChI | InChI=1S/C9H12O3S/c1-10-6-4-7(11-2)9(13)8(5-6)12-3/h4-5,13H,1-3H3 |
| InChIKey | DZWLIENCQXGZFF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4,6-trimethoxybenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-trimethoxybenzenethiol?
The IUPAC name of 2,4,6-trimethoxybenzenethiol (CID 12723003) is 2,4,6-trimethoxybenzenethiol.
What is the SMILES notation for 2,4,6-trimethoxybenzenethiol?
The canonical SMILES for 2,4,6-trimethoxybenzenethiol is COc1cc(OC)c(S)c(OC)c1.
What is the InChIKey of 2,4,6-trimethoxybenzenethiol?
The InChIKey is DZWLIENCQXGZFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3S/c1-10-6-4-7(11-2)9(13)8(5-6)12-3/h4-5,13H,1-3H3.
What are the key properties of 2,4,6-trimethoxybenzenethiol?
2,4,6-trimethoxybenzenethiol has a molecular weight of 200.26 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trimethoxybenzenethiol is sourced from PubChem (CID 12723003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).