About (2-oxocyclododecyl) acetate
(2-oxocyclododecyl) acetate (PubChem CID 12723137) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is (2-oxocyclododecyl) acetate.
Molecular Properties
| Compound Name | (2-oxocyclododecyl) acetate |
| PubChem CID | 12723137 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (2-oxocyclododecyl) acetate |
| SMILES | CC(=O)OC1CCCCCCCCCCC1=O |
| InChI | InChI=1S/C14H24O3/c1-12(15)17-14-11-9-7-5-3-2-4-6-8-10-13(14)16/h14H,2-11H2,1H3 |
| InChIKey | NNIWFQDGZUCXBB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-oxocyclododecyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxocyclododecyl) acetate?
The IUPAC name of (2-oxocyclododecyl) acetate (CID 12723137) is (2-oxocyclododecyl) acetate.
What is the SMILES notation for (2-oxocyclododecyl) acetate?
The canonical SMILES for (2-oxocyclododecyl) acetate is CC(=O)OC1CCCCCCCCCCC1=O.
What is the InChIKey of (2-oxocyclododecyl) acetate?
The InChIKey is NNIWFQDGZUCXBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O3/c1-12(15)17-14-11-9-7-5-3-2-4-6-8-10-13(14)16/h14H,2-11H2,1H3.
What are the key properties of (2-oxocyclododecyl) acetate?
(2-oxocyclododecyl) acetate has a molecular weight of 240.34 g/mol, XLogP of 3.40, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxocyclododecyl) acetate is sourced from PubChem (CID 12723137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).