About 3-(methoxymethyl)-2,2-dimethyloxirane
3-(methoxymethyl)-2,2-dimethyloxirane (PubChem CID 12723336) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is 3-(methoxymethyl)-2,2-dimethyloxirane.
Molecular Properties
| Compound Name | 3-(methoxymethyl)-2,2-dimethyloxirane |
| PubChem CID | 12723336 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | 3-(methoxymethyl)-2,2-dimethyloxirane |
| SMILES | COCC1OC1(C)C |
| InChI | InChI=1S/C6H12O2/c1-6(2)5(8-6)4-7-3/h5H,4H2,1-3H3 |
| InChIKey | FQEIFONQKLVETL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-(methoxymethyl)-2,2-dimethyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methoxymethyl)-2,2-dimethyloxirane?
The IUPAC name of 3-(methoxymethyl)-2,2-dimethyloxirane (CID 12723336) is 3-(methoxymethyl)-2,2-dimethyloxirane.
What is the SMILES notation for 3-(methoxymethyl)-2,2-dimethyloxirane?
The canonical SMILES for 3-(methoxymethyl)-2,2-dimethyloxirane is COCC1OC1(C)C.
What is the InChIKey of 3-(methoxymethyl)-2,2-dimethyloxirane?
The InChIKey is FQEIFONQKLVETL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2/c1-6(2)5(8-6)4-7-3/h5H,4H2,1-3H3.
What are the key properties of 3-(methoxymethyl)-2,2-dimethyloxirane?
3-(methoxymethyl)-2,2-dimethyloxirane has a molecular weight of 116.16 g/mol, XLogP of 0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methoxymethyl)-2,2-dimethyloxirane is sourced from PubChem (CID 12723336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).