About 3,6-dimethoxycyclohexene
3,6-dimethoxycyclohexene (PubChem CID 12723453) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 3,6-dimethoxycyclohexene.
Molecular Properties
| Compound Name | 3,6-dimethoxycyclohexene |
| PubChem CID | 12723453 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 3,6-dimethoxycyclohexene |
| SMILES | COC1C=CC(OC)CC1 |
| InChI | InChI=1S/C8H14O2/c1-9-7-3-5-8(10-2)6-4-7/h3,5,7-8H,4,6H2,1-2H3 |
| InChIKey | CCAYAWISXRRYIH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dimethoxycyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethoxycyclohexene?
The IUPAC name of 3,6-dimethoxycyclohexene (CID 12723453) is 3,6-dimethoxycyclohexene.
What is the SMILES notation for 3,6-dimethoxycyclohexene?
The canonical SMILES for 3,6-dimethoxycyclohexene is COC1C=CC(OC)CC1.
What is the InChIKey of 3,6-dimethoxycyclohexene?
The InChIKey is CCAYAWISXRRYIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-9-7-3-5-8(10-2)6-4-7/h3,5,7-8H,4,6H2,1-2H3.
What are the key properties of 3,6-dimethoxycyclohexene?
3,6-dimethoxycyclohexene has a molecular weight of 142.20 g/mol, XLogP of 1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethoxycyclohexene is sourced from PubChem (CID 12723453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).