About 2-hydroxy-2,2-dithiophen-2-ylacetic acid
2-hydroxy-2,2-dithiophen-2-ylacetic acid (PubChem CID 12723754) has the molecular formula C10H8O3S2
and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-hydroxy-2,2-dithiophen-2-ylacetic acid.
Molecular Properties
| Compound Name | 2-hydroxy-2,2-dithiophen-2-ylacetic acid |
| PubChem CID | 12723754 |
| Molecular Formula | C10H8O3S2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 2-hydroxy-2,2-dithiophen-2-ylacetic acid |
| SMILES | O=C(O)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C10H8O3S2/c11-9(12)10(13,7-3-1-5-14-7)8-4-2-6-15-8/h1-6,13H,(H,11,12) |
| InChIKey | FVEJUHUCFCAYRP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-2,2-dithiophen-2-ylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2,2-dithiophen-2-ylacetic acid?
The IUPAC name of 2-hydroxy-2,2-dithiophen-2-ylacetic acid (CID 12723754) is 2-hydroxy-2,2-dithiophen-2-ylacetic acid.
What is the SMILES notation for 2-hydroxy-2,2-dithiophen-2-ylacetic acid?
The canonical SMILES for 2-hydroxy-2,2-dithiophen-2-ylacetic acid is O=C(O)C(O)(c1cccs1)c1cccs1.
What is the InChIKey of 2-hydroxy-2,2-dithiophen-2-ylacetic acid?
The InChIKey is FVEJUHUCFCAYRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3S2/c11-9(12)10(13,7-3-1-5-14-7)8-4-2-6-15-8/h1-6,13H,(H,11,12).
What are the key properties of 2-hydroxy-2,2-dithiophen-2-ylacetic acid?
2-hydroxy-2,2-dithiophen-2-ylacetic acid has a molecular weight of 240.31 g/mol, XLogP of 2.13, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2,2-dithiophen-2-ylacetic acid is sourced from PubChem (CID 12723754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).