About 7-methoxy-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid
7-methoxy-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid (PubChem CID 12724106) has the molecular formula C14H9NO6
and a molecular weight of 287.23 g/mol. Its IUPAC name is 7-methoxy-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid.
Molecular Properties
| Compound Name | 7-methoxy-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid |
| PubChem CID | 12724106 |
| Molecular Formula | C14H9NO6 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 7-methoxy-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid |
| SMILES | COc1cccc2c1[nH]c(=O)c1c(=O)cc(C(=O)O)oc12 |
| InChI | InChI=1S/C14H9NO6/c1-20-8-4-2-3-6-11(8)15-13(17)10-7(16)5-9(14(18)19)21-12(6)10/h2-5H,1H3,(H,15,17)(H,18,19) |
| InChIKey | QXJXJDMEWJEROQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid?
The IUPAC name of 7-methoxy-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid (CID 12724106) is 7-methoxy-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid.
What is the SMILES notation for 7-methoxy-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid?
The canonical SMILES for 7-methoxy-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid is COc1cccc2c1[nH]c(=O)c1c(=O)cc(C(=O)O)oc12.
What is the InChIKey of 7-methoxy-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid?
The InChIKey is QXJXJDMEWJEROQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO6/c1-20-8-4-2-3-6-11(8)15-13(17)10-7(16)5-9(14(18)19)21-12(6)10/h2-5H,1H3,(H,15,17)(H,18,19).
What are the key properties of 7-methoxy-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid?
7-methoxy-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid has a molecular weight of 287.23 g/mol, XLogP of 1.34, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid is sourced from PubChem (CID 12724106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).