About 9-chloro-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid
9-chloro-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid (PubChem CID 12724107) has the molecular formula C13H6ClNO5
and a molecular weight of 291.65 g/mol. Its IUPAC name is 9-chloro-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid.
Molecular Properties
| Compound Name | 9-chloro-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid |
| PubChem CID | 12724107 |
| Molecular Formula | C13H6ClNO5 |
| Molecular Weight | 291.65 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 9-chloro-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)c2c(=O)[nH]c3ccc(Cl)cc3c2o1 |
| InChI | InChI=1S/C13H6ClNO5/c14-5-1-2-7-6(3-5)11-10(12(17)15-7)8(16)4-9(20-11)13(18)19/h1-4H,(H,15,17)(H,18,19) |
| InChIKey | KWBWYILPZNWIMF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.65 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-chloro-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid?
The IUPAC name of 9-chloro-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid (CID 12724107) is 9-chloro-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid.
What is the SMILES notation for 9-chloro-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid?
The canonical SMILES for 9-chloro-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid is O=C(O)c1cc(=O)c2c(=O)[nH]c3ccc(Cl)cc3c2o1.
What is the InChIKey of 9-chloro-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid?
The InChIKey is KWBWYILPZNWIMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6ClNO5/c14-5-1-2-7-6(3-5)11-10(12(17)15-7)8(16)4-9(20-11)13(18)19/h1-4H,(H,15,17)(H,18,19).
What are the key properties of 9-chloro-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid?
9-chloro-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid has a molecular weight of 291.65 g/mol, XLogP of 1.99, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid is sourced from PubChem (CID 12724107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).