C11H11N3OS2 — CID 12724306
3,8-dithia-10,12,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-13-one (PubChem CID 12724306) has the molecular formula C11H11N3OS2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 3,8-dithia-10,12,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-13-one.
| Compound Name | 3,8-dithia-10,12,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-13-one |
|---|---|
| PubChem CID | 12724306 |
| Molecular Formula | C11H11N3OS2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 3,8-dithia-10,12,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-13-one |
| SMILES | O=C1CN2Cc3c(sc4c3SCCC4)N=C2N1 |
| InChI | InChI=1S/C11H11N3OS2/c15-8-5-14-4-6-9-7(2-1-3-16-9)17-10(6)13-11(14)12-8/h1-5H2,(H,12,13,15) |
| InChIKey | KPPIHZGUYLZBHZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |