C15H20N4O2 — CID 127245914
1-(2-cyclopropylacetyl)-N-methyl-2-pyrazin-2-ylpyrrolidine-2-carboxamide (PubChem CID 127245914) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-(2-cyclopropylacetyl)-N-methyl-2-pyrazin-2-ylpyrrolidine-2-carboxamide.
| Compound Name | 1-(2-cyclopropylacetyl)-N-methyl-2-pyrazin-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 127245914 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-(2-cyclopropylacetyl)-N-methyl-2-pyrazin-2-ylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1(c2cnccn2)CCCN1C(=O)CC1CC1 |
| InChI | InChI=1S/C15H20N4O2/c1-16-14(21)15(12-10-17-6-7-18-12)5-2-8-19(15)13(20)9-11-3-4-11/h6-7,10-11H,2-5,8-9H2,1H3,(H,16,21) |
| InChIKey | URNSPPKHWROUJN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |