C16H19N3O3S — CID 127246320
4-[(4-methylsulfonylphenyl)methyl]-2-pyrazin-2-ylmorpholine (PubChem CID 127246320) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 4-[(4-methylsulfonylphenyl)methyl]-2-pyrazin-2-ylmorpholine.
| Compound Name | 4-[(4-methylsulfonylphenyl)methyl]-2-pyrazin-2-ylmorpholine |
|---|---|
| PubChem CID | 127246320 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 4-[(4-methylsulfonylphenyl)methyl]-2-pyrazin-2-ylmorpholine |
| SMILES | CS(=O)(=O)c1ccc(CN2CCOC(c3cnccn3)C2)cc1 |
| InChI | InChI=1S/C16H19N3O3S/c1-23(20,21)14-4-2-13(3-5-14)11-19-8-9-22-16(12-19)15-10-17-6-7-18-15/h2-7,10,16H,8-9,11-12H2,1H3 |
| InChIKey | DJWDSYQRXQJGEJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |