About 2-[[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]methyl]-5-methoxy-1H-indole
2-[[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]methyl]-5-methoxy-1H-indole (PubChem CID 127246676) has the molecular formula C20H24N4O
and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]methyl]-5-methoxy-1H-indole.
Molecular Properties
| Compound Name | 2-[[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]methyl]-5-methoxy-1H-indole |
| PubChem CID | 127246676 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-[[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]methyl]-5-methoxy-1H-indole |
| SMILES | COc1ccc2[nH]c(CN3CCC(c4nc(C)cc(C)n4)C3)cc2c1 |
| InChI | InChI=1S/C20H24N4O/c1-13-8-14(2)22-20(21-13)15-6-7-24(11-15)12-17-9-16-10-18(25-3)4-5-19(16)23-17/h4-5,8-10,15,23H,6-7,11-12H2,1-3H3 |
| InChIKey | XCBVSSNSDNFRNE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]methyl]-5-methoxy-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]methyl]-5-methoxy-1H-indole?
The IUPAC name of 2-[[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]methyl]-5-methoxy-1H-indole (CID 127246676) is 2-[[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]methyl]-5-methoxy-1H-indole.
What is the SMILES notation for 2-[[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]methyl]-5-methoxy-1H-indole?
The canonical SMILES for 2-[[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]methyl]-5-methoxy-1H-indole is COc1ccc2[nH]c(CN3CCC(c4nc(C)cc(C)n4)C3)cc2c1.
What is the InChIKey of 2-[[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]methyl]-5-methoxy-1H-indole?
The InChIKey is XCBVSSNSDNFRNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O/c1-13-8-14(2)22-20(21-13)15-6-7-24(11-15)12-17-9-16-10-18(25-3)4-5-19(16)23-17/h4-5,8-10,15,23H,6-7,11-12H2,1-3H3.
What are the key properties of 2-[[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]methyl]-5-methoxy-1H-indole?
2-[[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]methyl]-5-methoxy-1H-indole has a molecular weight of 336.44 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(4,6-dimethylpyrimidin-2-yl)pyrrolidin-1-yl]methyl]-5-methoxy-1H-indole is sourced from PubChem (CID 127246676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).