C17H23FN2O4 — CID 127248054
(3-fluoro-4-methoxyphenyl)-[3-hydroxy-3-(morpholin-4-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 127248054) has the molecular formula C17H23FN2O4 and a molecular weight of 338.38 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)-[3-hydroxy-3-(morpholin-4-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (3-fluoro-4-methoxyphenyl)-[3-hydroxy-3-(morpholin-4-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 127248054 |
| Molecular Formula | C17H23FN2O4 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)-[3-hydroxy-3-(morpholin-4-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCC(O)(CN3CCOCC3)C2)cc1F |
| InChI | InChI=1S/C17H23FN2O4/c1-23-15-3-2-13(10-14(15)18)16(21)20-5-4-17(22,12-20)11-19-6-8-24-9-7-19/h2-3,10,22H,4-9,11-12H2,1H3 |
| InChIKey | UHTMRJGDDFYFIO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |