C15H23FN2O3S — CID 127248085
1-ethylsulfonyl-3-[[(4-fluorophenyl)methyl-methylamino]methyl]pyrrolidin-3-ol (PubChem CID 127248085) has the molecular formula C15H23FN2O3S and a molecular weight of 330.42 g/mol. Its IUPAC name is 1-ethylsulfonyl-3-[[(4-fluorophenyl)methyl-methylamino]methyl]pyrrolidin-3-ol.
| Compound Name | 1-ethylsulfonyl-3-[[(4-fluorophenyl)methyl-methylamino]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 127248085 |
| Molecular Formula | C15H23FN2O3S |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-ethylsulfonyl-3-[[(4-fluorophenyl)methyl-methylamino]methyl]pyrrolidin-3-ol |
| SMILES | CCS(=O)(=O)N1CCC(O)(CN(C)Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C15H23FN2O3S/c1-3-22(20,21)18-9-8-15(19,12-18)11-17(2)10-13-4-6-14(16)7-5-13/h4-7,19H,3,8-12H2,1-2H3 |
| InChIKey | DLCRFYOHFBGXIN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |