C22H24N4O3S — CID 127249177
6-[4-(3,4-dimethylphenyl)sulfonylmorpholin-2-yl]-N-pyridin-2-ylpyridin-3-amine (PubChem CID 127249177) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is 6-[4-(3,4-dimethylphenyl)sulfonylmorpholin-2-yl]-N-pyridin-2-ylpyridin-3-amine.
| Compound Name | 6-[4-(3,4-dimethylphenyl)sulfonylmorpholin-2-yl]-N-pyridin-2-ylpyridin-3-amine |
|---|---|
| PubChem CID | 127249177 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 6-[4-(3,4-dimethylphenyl)sulfonylmorpholin-2-yl]-N-pyridin-2-ylpyridin-3-amine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOC(c3ccc(Nc4ccccn4)cn3)C2)cc1C |
| InChI | InChI=1S/C22H24N4O3S/c1-16-6-8-19(13-17(16)2)30(27,28)26-11-12-29-21(15-26)20-9-7-18(14-24-20)25-22-5-3-4-10-23-22/h3-10,13-14,21H,11-12,15H2,1-2H3,(H,23,25) |
| InChIKey | QEOIVFXSMKMCBI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |