C19H24ClN3O2 — CID 127249434
1-[3-[5-[(3-chlorophenoxy)methyl]-1H-pyrazol-3-yl]pyrrolidin-1-yl]-3-methylbutan-1-one (PubChem CID 127249434) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is 1-[3-[5-[(3-chlorophenoxy)methyl]-1H-pyrazol-3-yl]pyrrolidin-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[3-[5-[(3-chlorophenoxy)methyl]-1H-pyrazol-3-yl]pyrrolidin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 127249434 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 1-[3-[5-[(3-chlorophenoxy)methyl]-1H-pyrazol-3-yl]pyrrolidin-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1CCC(c2cc(COc3cccc(Cl)c3)[nH]n2)C1 |
| InChI | InChI=1S/C19H24ClN3O2/c1-13(2)8-19(24)23-7-6-14(11-23)18-10-16(21-22-18)12-25-17-5-3-4-15(20)9-17/h3-5,9-10,13-14H,6-8,11-12H2,1-2H3,(H,21,22) |
| InChIKey | JNQBQSJXPRNVHG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |