About propan-2-ylurea
propan-2-ylurea (PubChem CID 12725) has the molecular formula C4H10N2O
and a molecular weight of 102.14 g/mol. Its IUPAC name is propan-2-ylurea.
Molecular Properties
| Compound Name | propan-2-ylurea |
| PubChem CID | 12725 |
| Molecular Formula | C4H10N2O |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | propan-2-ylurea |
| SMILES | CC(C)NC(N)=O |
| InChI | InChI=1S/C4H10N2O/c1-3(2)6-4(5)7/h3H,1-2H3,(H3,5,6,7) |
| InChIKey | LZMATGARSSLFMQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propan-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ylurea?
The IUPAC name of propan-2-ylurea (CID 12725) is propan-2-ylurea.
What is the SMILES notation for propan-2-ylurea?
The canonical SMILES for propan-2-ylurea is CC(C)NC(N)=O.
What is the InChIKey of propan-2-ylurea?
The InChIKey is LZMATGARSSLFMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O/c1-3(2)6-4(5)7/h3H,1-2H3,(H3,5,6,7).
What are the key properties of propan-2-ylurea?
propan-2-ylurea has a molecular weight of 102.14 g/mol, XLogP of 0.06, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ylurea is sourced from PubChem (CID 12725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).