C24H26N4O3 — CID 127251199
4-[3-[4-[(2-methoxy-4-methylphenyl)methyl]morpholin-2-yl]pyrazin-2-yl]benzamide (PubChem CID 127251199) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 4-[3-[4-[(2-methoxy-4-methylphenyl)methyl]morpholin-2-yl]pyrazin-2-yl]benzamide.
| Compound Name | 4-[3-[4-[(2-methoxy-4-methylphenyl)methyl]morpholin-2-yl]pyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 127251199 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 4-[3-[4-[(2-methoxy-4-methylphenyl)methyl]morpholin-2-yl]pyrazin-2-yl]benzamide |
| SMILES | COc1cc(C)ccc1CN1CCOC(c2nccnc2-c2ccc(C(N)=O)cc2)C1 |
| InChI | InChI=1S/C24H26N4O3/c1-16-3-4-19(20(13-16)30-2)14-28-11-12-31-21(15-28)23-22(26-9-10-27-23)17-5-7-18(8-6-17)24(25)29/h3-10,13,21H,11-12,14-15H2,1-2H3,(H2,25,29) |
| InChIKey | MTUXBEJAXOOFBU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |