C20H26N4O — CID 127252489
[(3S,3aS,7aR)-3-(4-ethylphenyl)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-c]pyridin-1-yl]-(1-methylpyrazol-4-yl)methanone (PubChem CID 127252489) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is [(3S,3aS,7aR)-3-(4-ethylphenyl)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-c]pyridin-1-yl]-(1-methylpyrazol-4-yl)methanone.
| Compound Name | [(3S,3aS,7aR)-3-(4-ethylphenyl)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-c]pyridin-1-yl]-(1-methylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 127252489 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | [(3S,3aS,7aR)-3-(4-ethylphenyl)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-c]pyridin-1-yl]-(1-methylpyrazol-4-yl)methanone |
| SMILES | CCc1ccc([C@H]2CN(C(=O)c3cnn(C)c3)[C@@H]3CCNC[C@H]23)cc1 |
| InChI | InChI=1S/C20H26N4O/c1-3-14-4-6-15(7-5-14)18-13-24(19-8-9-21-11-17(18)19)20(25)16-10-22-23(2)12-16/h4-7,10,12,17-19,21H,3,8-9,11,13H2,1-2H3/t17-,18-,19-/m1/s1 |
| InChIKey | BYEXJEFRMMTJEC-GUDVDZBRSA-N |
| XLogP | 2.20 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |