C23H21N5O4 — CID 127252642
3,4-dimethoxy-6-[2-[(2-methyl-1,2,4-triazol-3-yl)amino]ethyl]indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 127252642) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is 3,4-dimethoxy-6-[2-[(2-methyl-1,2,4-triazol-3-yl)amino]ethyl]indeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 3,4-dimethoxy-6-[2-[(2-methyl-1,2,4-triazol-3-yl)amino]ethyl]indeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 127252642 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 3,4-dimethoxy-6-[2-[(2-methyl-1,2,4-triazol-3-yl)amino]ethyl]indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | COc1ccc2c3c(n(CCNc4ncnn4C)c(=O)c2c1OC)-c1ccccc1C3=O |
| InChI | InChI=1S/C23H21N5O4/c1-27-23(25-12-26-27)24-10-11-28-19-13-6-4-5-7-14(13)20(29)17(19)15-8-9-16(31-2)21(32-3)18(15)22(28)30/h4-9,12H,10-11H2,1-3H3,(H,24,25,26) |
| InChIKey | FPSHYMAJXVABKZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|