C21H15NO4 — CID 127252656
3,4-dimethoxy-6-prop-2-ynylindeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 127252656) has the molecular formula C21H15NO4 and a molecular weight of 345.35 g/mol. Its IUPAC name is 3,4-dimethoxy-6-prop-2-ynylindeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 3,4-dimethoxy-6-prop-2-ynylindeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 127252656 |
| Molecular Formula | C21H15NO4 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 3,4-dimethoxy-6-prop-2-ynylindeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | C#CCn1c2c(c3ccc(OC)c(OC)c3c1=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C21H15NO4/c1-4-11-22-18-12-7-5-6-8-13(12)19(23)16(18)14-9-10-15(25-2)20(26-3)17(14)21(22)24/h1,5-10H,11H2,2-3H3 |
| InChIKey | QKMQYMSOCKZZOS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|