C24H17N3O5 — CID 127252794
N-(3,4-dimethoxy-5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)pyridine-3-carboxamide (PubChem CID 127252794) has the molecular formula C24H17N3O5 and a molecular weight of 427.42 g/mol. Its IUPAC name is N-(3,4-dimethoxy-5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)pyridine-3-carboxamide.
| Compound Name | N-(3,4-dimethoxy-5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 127252794 |
| Molecular Formula | C24H17N3O5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | N-(3,4-dimethoxy-5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)pyridine-3-carboxamide |
| SMILES | COc1ccc2c3c(n(NC(=O)c4cccnc4)c(=O)c2c1OC)-c1ccccc1C3=O |
| InChI | InChI=1S/C24H17N3O5/c1-31-17-10-9-16-18-20(14-7-3-4-8-15(14)21(18)28)27(24(30)19(16)22(17)32-2)26-23(29)13-6-5-11-25-12-13/h3-12H,1-2H3,(H,26,29) |
| InChIKey | UFYFYQOKHQRUMF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|