C24H17NO4 — CID 127252797
6-[2-(3,4-dihydroxyphenyl)ethyl]indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 127252797) has the molecular formula C24H17NO4 and a molecular weight of 383.40 g/mol. Its IUPAC name is 6-[2-(3,4-dihydroxyphenyl)ethyl]indeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-[2-(3,4-dihydroxyphenyl)ethyl]indeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 127252797 |
| Molecular Formula | C24H17NO4 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 6-[2-(3,4-dihydroxyphenyl)ethyl]indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | O=C1c2ccccc2-c2c1c1ccccc1c(=O)n2CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C24H17NO4/c26-19-10-9-14(13-20(19)27)11-12-25-22-16-6-2-3-7-17(16)23(28)21(22)15-5-1-4-8-18(15)24(25)29/h1-10,13,26-27H,11-12H2 |
| InChIKey | RXDCEZSPFMIMEM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|