C35H30ClN3O9 — CID 127252822
(2S,8'R)-5'-[5-(4-acetylphenyl)furan-2-yl]-7-chloro-4,6-dimethoxy-1',3',8'-trimethylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone (PubChem CID 127252822) has the molecular formula C35H30ClN3O9 and a molecular weight of 672.09 g/mol. Its IUPAC name is (2S,8'R)-5'-[5-(4-acetylphenyl)furan-2-yl]-7-chloro-4,6-dimethoxy-1',3',8'-trimethylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone.
| Compound Name | (2S,8'R)-5'-[5-(4-acetylphenyl)furan-2-yl]-7-chloro-4,6-dimethoxy-1',3',8'-trimethylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone |
|---|---|
| PubChem CID | 127252822 |
| Molecular Formula | C35H30ClN3O9 |
| Molecular Weight | 672.09 g/mol |
| Exact Mass | 671.17 |
| IUPAC Name | (2S,8'R)-5'-[5-(4-acetylphenyl)furan-2-yl]-7-chloro-4,6-dimethoxy-1',3',8'-trimethylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C3=C(C[C@H]1C)Nc1c(c(=O)n(C)c(=O)n1C)C3c1ccc(-c3ccc(C(C)=O)cc3)o1)C2=O |
| InChI | InChI=1S/C35H30ClN3O9/c1-15-13-19-24(30(41)35(15)31(42)26-22(45-5)14-23(46-6)28(36)29(26)48-35)25(27-32(37-19)38(3)34(44)39(4)33(27)43)21-12-11-20(47-21)18-9-7-17(8-10-18)16(2)40/h7-12,14-15,25,37H,13H2,1-6H3/t15-,25?,35+/m1/s1 |
| InChIKey | HADRQEOWJIPADM-AZCPRBICSA-N |
| XLogP | 4.65 |
| TPSA | 148.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.09 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|