C28H23NO5 — CID 127252853
6-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,4-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 127252853) has the molecular formula C28H23NO5 and a molecular weight of 453.49 g/mol. Its IUPAC name is 6-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,4-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,4-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 127252853 |
| Molecular Formula | C28H23NO5 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 6-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3,4-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | COc1ccc2c3c(n(CC4OCCc5ccccc54)c(=O)c2c1OC)-c1ccccc1C3=O |
| InChI | InChI=1S/C28H23NO5/c1-32-21-12-11-20-23-25(18-9-5-6-10-19(18)26(23)30)29(28(31)24(20)27(21)33-2)15-22-17-8-4-3-7-16(17)13-14-34-22/h3-12,22H,13-15H2,1-2H3 |
| InChIKey | CGQVCCMBBDXTGI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|