C14H18O2S — CID 12725301
2-(phenylsulfanylmethyl)cyclohexane-1-carboxylic acid (PubChem CID 12725301) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-(phenylsulfanylmethyl)cyclohexane-1-carboxylic acid.
| Compound Name | 2-(phenylsulfanylmethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 12725301 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-(phenylsulfanylmethyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1CSc1ccccc1 |
| InChI | InChI=1S/C14H18O2S/c15-14(16)13-9-5-4-6-11(13)10-17-12-7-2-1-3-8-12/h1-3,7-8,11,13H,4-6,9-10H2,(H,15,16) |
| InChIKey | IMHSDNULRKCRML-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |